C18H17Cl6N3O — CID 54162086
2-[2-(4-pentoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 54162086) has the molecular formula C18H17Cl6N3O and a molecular weight of 504.07 g/mol. Its IUPAC name is 2-[2-(4-pentoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[2-(4-pentoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 54162086 |
| Molecular Formula | C18H17Cl6N3O |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 500.95 |
| IUPAC Name | 2-[2-(4-pentoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CCCCCOc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C18H17Cl6N3O/c1-2-3-4-11-28-13-8-5-12(6-9-13)7-10-14-25-15(17(19,20)21)27-16(26-14)18(22,23)24/h5-10H,2-4,11H2,1H3 |
| InChIKey | OPCSNSADWKDQDU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|