C30H22Cl12N6O2 — CID 162222354
2-[2-(4-ethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 162222354) has the molecular formula C30H22Cl12N6O2 and a molecular weight of 923.98 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[2-(4-ethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162222354 |
| Molecular Formula | C30H22Cl12N6O2 |
| Molecular Weight | 923.98 g/mol |
| Exact Mass | 917.81 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CCOc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1.CCOc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/2C15H11Cl6N3O/c2*1-2-25-10-6-3-9(4-7-10)5-8-11-22-12(14(16,17)18)24-13(23-11)15(19,20)21/h2*3-8H,2H2,1H3 |
| InChIKey | ZUHHJXWSAQIMAL-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.98 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|