About 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride
1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride (PubChem CID 68721726) has the molecular formula C21H30Cl2N2
and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride |
| PubChem CID | 68721726 |
| Molecular Formula | C21H30Cl2N2 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride |
| SMILES | CC(CCN1CCC(N)CC1)(c1ccccc1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H28N2.2ClH/c1-21(18-8-4-2-5-9-18,19-10-6-3-7-11-19)14-17-23-15-12-20(22)13-16-23;;/h2-11,20H,12-17,22H2,1H3;2*1H |
| InChIKey | CJWXOURYNKRLHN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride?
The IUPAC name of 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride (CID 68721726) is 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride.
What is the SMILES notation for 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride?
The canonical SMILES for 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride is CC(CCN1CCC(N)CC1)(c1ccccc1)c1ccccc1.Cl.Cl.
What is the InChIKey of 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride?
The InChIKey is CJWXOURYNKRLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2.2ClH/c1-21(18-8-4-2-5-9-18,19-10-6-3-7-11-19)14-17-23-15-12-20(22)13-16-23;;/h2-11,20H,12-17,22H2,1H3;2*1H.
What are the key properties of 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride?
1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride has a molecular weight of 381.39 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diphenylbutyl)piperidin-4-amine;dihydrochloride is sourced from PubChem (CID 68721726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).