C14H16N2O4 — CID 68726339
methyl 2-(2,4-dioxo-1H-quinazolin-3-yl)pentanoate (PubChem CID 68726339) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 2-(2,4-dioxo-1H-quinazolin-3-yl)pentanoate.
| Compound Name | methyl 2-(2,4-dioxo-1H-quinazolin-3-yl)pentanoate |
|---|---|
| PubChem CID | 68726339 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 2-(2,4-dioxo-1H-quinazolin-3-yl)pentanoate |
| SMILES | CCCC(C(=O)OC)n1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C14H16N2O4/c1-3-6-11(13(18)20-2)16-12(17)9-7-4-5-8-10(9)15-14(16)19/h4-5,7-8,11H,3,6H2,1-2H3,(H,15,19) |
| InChIKey | ROAADFVJPNIJBA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |