methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate

C16H20N2O5 — CID 68751633

IUPACmethyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate
SMILESCCCCC(C(=O)OC)n1c(=O)[nH]c2cc(OC)ccc2c1=O
InChIInChI=1S/C16H20N2O5/c1-4-5-6-13(15(20)23-3)18-14(19)11-8-7-10(22-2)9-12(11)17-16(18)21/h7-9,13H,4-6H2,1-3H3,(H,17,21)
InChIKeyGLGLMZGEYDGGCF-UHFFFAOYSA-N
MW320.35 g/mol
LogP1.60
Rot. Bonds6

About methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate

methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate (PubChem CID 68751633) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate.

Molecular Properties

Compound Namemethyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate
PubChem CID68751633
Molecular FormulaC16H20N2O5
Molecular Weight320.35 g/mol
Exact Mass320.14
IUPAC Namemethyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate
SMILESCCCCC(C(=O)OC)n1c(=O)[nH]c2cc(OC)ccc2c1=O
InChIInChI=1S/C16H20N2O5/c1-4-5-6-13(15(20)23-3)18-14(19)11-8-7-10(22-2)9-12(11)17-16(18)21/h7-9,13H,4-6H2,1-3H3,(H,17,21)
InChIKeyGLGLMZGEYDGGCF-UHFFFAOYSA-N
XLogP1.60
TPSA90.39 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.35
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate?
The IUPAC name of methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate (CID 68751633) is methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate.
What is the SMILES notation for methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate?
The canonical SMILES for methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate is CCCCC(C(=O)OC)n1c(=O)[nH]c2cc(OC)ccc2c1=O.
What is the InChIKey of methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate?
The InChIKey is GLGLMZGEYDGGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O5/c1-4-5-6-13(15(20)23-3)18-14(19)11-8-7-10(22-2)9-12(11)17-16(18)21/h7-9,13H,4-6H2,1-3H3,(H,17,21).
What are the key properties of methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate?
methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate has a molecular weight of 320.35 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(7-methoxy-2,4-dioxo-1H-quinazolin-3-yl)hexanoate is sourced from PubChem (CID 68751633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).