C18H18ClFN2O4S — CID 68730046
4-(3-chlorophenyl)sulfonyl-1-(4-fluoro-2-methylphenyl)piperazine-2-carboxylic acid (PubChem CID 68730046) has the molecular formula C18H18ClFN2O4S and a molecular weight of 412.87 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-1-(4-fluoro-2-methylphenyl)piperazine-2-carboxylic acid.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-1-(4-fluoro-2-methylphenyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 68730046 |
| Molecular Formula | C18H18ClFN2O4S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-1-(4-fluoro-2-methylphenyl)piperazine-2-carboxylic acid |
| SMILES | Cc1cc(F)ccc1N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1C(=O)O |
| InChI | InChI=1S/C18H18ClFN2O4S/c1-12-9-14(20)5-6-16(12)22-8-7-21(11-17(22)18(23)24)27(25,26)15-4-2-3-13(19)10-15/h2-6,9-10,17H,7-8,11H2,1H3,(H,23,24) |
| InChIKey | JVQORJQVVBWVPN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |