C23H23N3O5S — CID 68731096
2-[(2-aminophenyl)carbamoyl]-4-(2,3-dimethoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylic acid (PubChem CID 68731096) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[(2-aminophenyl)carbamoyl]-4-(2,3-dimethoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylic acid.
| Compound Name | 2-[(2-aminophenyl)carbamoyl]-4-(2,3-dimethoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 68731096 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[(2-aminophenyl)carbamoyl]-4-(2,3-dimethoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylic acid |
| SMILES | COc1cccc(C2c3cc(C(=O)Nc4ccccc4N)sc3CCN2C(=O)O)c1OC |
| InChI | InChI=1S/C23H23N3O5S/c1-30-17-9-5-6-13(21(17)31-2)20-14-12-19(32-18(14)10-11-26(20)23(28)29)22(27)25-16-8-4-3-7-15(16)24/h3-9,12,20H,10-11,24H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | SLEDPBAEPHVUAO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|