About 1-oxaspiro[4.4]nonane-2,8-dione
1-oxaspiro[4.4]nonane-2,8-dione (PubChem CID 68731112) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 1-oxaspiro[4.4]nonane-2,8-dione.
Molecular Properties
| Compound Name | 1-oxaspiro[4.4]nonane-2,8-dione |
| PubChem CID | 68731112 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-oxaspiro[4.4]nonane-2,8-dione |
| SMILES | O=C1CCC2(CCC(=O)O2)C1 |
| InChI | InChI=1S/C8H10O3/c9-6-1-3-8(5-6)4-2-7(10)11-8/h1-5H2 |
| InChIKey | AZCXGYSFQALJOA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxaspiro[4.4]nonane-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[4.4]nonane-2,8-dione?
The IUPAC name of 1-oxaspiro[4.4]nonane-2,8-dione (CID 68731112) is 1-oxaspiro[4.4]nonane-2,8-dione.
What is the SMILES notation for 1-oxaspiro[4.4]nonane-2,8-dione?
The canonical SMILES for 1-oxaspiro[4.4]nonane-2,8-dione is O=C1CCC2(CCC(=O)O2)C1.
What is the InChIKey of 1-oxaspiro[4.4]nonane-2,8-dione?
The InChIKey is AZCXGYSFQALJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c9-6-1-3-8(5-6)4-2-7(10)11-8/h1-5H2.
What are the key properties of 1-oxaspiro[4.4]nonane-2,8-dione?
1-oxaspiro[4.4]nonane-2,8-dione has a molecular weight of 154.16 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[4.4]nonane-2,8-dione is sourced from PubChem (CID 68731112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).