C11H12BrFN2O — CID 68731705
1-(5-bromo-4-fluoro-2-methylphenyl)piperazin-2-one (PubChem CID 68731705) has the molecular formula C11H12BrFN2O and a molecular weight of 287.13 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylphenyl)piperazin-2-one.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 68731705 |
| Molecular Formula | C11H12BrFN2O |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylphenyl)piperazin-2-one |
| SMILES | Cc1cc(F)c(Br)cc1N1CCNCC1=O |
| InChI | InChI=1S/C11H12BrFN2O/c1-7-4-9(13)8(12)5-10(7)15-3-2-14-6-11(15)16/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | NUQWPWIEEYEZFI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |