C21H19Cl2NO — CID 68731862
4-[2-(2,4-dichlorophenyl)propyl]-2-phenylmethoxypyridine (PubChem CID 68731862) has the molecular formula C21H19Cl2NO and a molecular weight of 372.30 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)propyl]-2-phenylmethoxypyridine.
| Compound Name | 4-[2-(2,4-dichlorophenyl)propyl]-2-phenylmethoxypyridine |
|---|---|
| PubChem CID | 68731862 |
| Molecular Formula | C21H19Cl2NO |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-[2-(2,4-dichlorophenyl)propyl]-2-phenylmethoxypyridine |
| SMILES | CC(Cc1ccnc(OCc2ccccc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19Cl2NO/c1-15(19-8-7-18(22)13-20(19)23)11-17-9-10-24-21(12-17)25-14-16-5-3-2-4-6-16/h2-10,12-13,15H,11,14H2,1H3 |
| InChIKey | SZXIOCMXHGPKDX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |