C37H30Cl4F6N2O4 — CID 159137685
4-[3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1H-pyridin-2-one;3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-(2-phenylmethoxy-4-pyridinyl)butan-2-ol (PubChem CID 159137685) has the molecular formula C37H30Cl4F6N2O4 and a molecular weight of 822.46 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1H-pyridin-2-one;3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-(2-phenylmethoxy-4-pyridinyl)butan-2-ol.
| Compound Name | 4-[3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1H-pyridin-2-one;3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-(2-phenylmethoxy-4-pyridinyl)butan-2-ol |
|---|---|
| PubChem CID | 159137685 |
| Molecular Formula | C37H30Cl4F6N2O4 |
| Molecular Weight | 822.46 g/mol |
| Exact Mass | 820.09 |
| IUPAC Name | 4-[3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1H-pyridin-2-one;3-(2,4-dichlorophenyl)-1,1,1-trifluoro-2-(2-phenylmethoxy-4-pyridinyl)butan-2-ol |
| SMILES | CC(c1ccc(Cl)cc1Cl)C(O)(c1cc[nH]c(=O)c1)C(F)(F)F.CC(c1ccc(Cl)cc1Cl)C(O)(c1ccnc(OCc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H18Cl2F3NO2.C15H12Cl2F3NO2/c1-14(18-8-7-17(23)12-19(18)24)21(29,22(25,26)27)16-9-10-28-20(11-16)30-13-15-5-3-2-4-6-15;1-8(11-3-2-10(16)7-12(11)17)14(23,15(18,19)20)9-4-5-21-13(22)6-9/h2-12,14,29H,13H2,1H3;2-8,23H,1H3,(H,21,22) |
| InChIKey | KHRZJSBGTZPPQR-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.46 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |