C27H31FO4 — CID 68732591
(3R)-3-[3-[(3-butoxy-3-fluoro-4-phenylcyclohexa-1,5-dien-1-yl)methoxy]phenyl]butanoic acid (PubChem CID 68732591) has the molecular formula C27H31FO4 and a molecular weight of 438.54 g/mol. Its IUPAC name is (3R)-3-[3-[(3-butoxy-3-fluoro-4-phenylcyclohexa-1,5-dien-1-yl)methoxy]phenyl]butanoic acid.
| Compound Name | (3R)-3-[3-[(3-butoxy-3-fluoro-4-phenylcyclohexa-1,5-dien-1-yl)methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 68732591 |
| Molecular Formula | C27H31FO4 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (3R)-3-[3-[(3-butoxy-3-fluoro-4-phenylcyclohexa-1,5-dien-1-yl)methoxy]phenyl]butanoic acid |
| SMILES | CCCCOC1(F)C=C(COc2cccc([C@H](C)CC(=O)O)c2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C27H31FO4/c1-3-4-15-32-27(28)18-21(13-14-25(27)22-9-6-5-7-10-22)19-31-24-12-8-11-23(17-24)20(2)16-26(29)30/h5-14,17-18,20,25H,3-4,15-16,19H2,1-2H3,(H,29,30)/t20-,25?,27?/m1/s1 |
| InChIKey | VSKFJZMCWOSBDT-VYVOKACLSA-N |
| XLogP | 6.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|