C21H25BrO4 — CID 68756458
(3S)-3-[3-[(4-bromo-3-butoxyphenyl)methoxy]phenyl]butanoic acid (PubChem CID 68756458) has the molecular formula C21H25BrO4 and a molecular weight of 421.33 g/mol. Its IUPAC name is (3S)-3-[3-[(4-bromo-3-butoxyphenyl)methoxy]phenyl]butanoic acid.
| Compound Name | (3S)-3-[3-[(4-bromo-3-butoxyphenyl)methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 68756458 |
| Molecular Formula | C21H25BrO4 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (3S)-3-[3-[(4-bromo-3-butoxyphenyl)methoxy]phenyl]butanoic acid |
| SMILES | CCCCOc1cc(COc2cccc([C@@H](C)CC(=O)O)c2)ccc1Br |
| InChI | InChI=1S/C21H25BrO4/c1-3-4-10-25-20-12-16(8-9-19(20)22)14-26-18-7-5-6-17(13-18)15(2)11-21(23)24/h5-9,12-13,15H,3-4,10-11,14H2,1-2H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | HWJDWUZEIXAFLX-HNNXBMFYSA-N |
| XLogP | 5.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|