C32H48N2O8 — CID 68732883
bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2-(2-aminoethylamino)octanedioate (PubChem CID 68732883) has the molecular formula C32H48N2O8 and a molecular weight of 588.74 g/mol. Its IUPAC name is bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2-(2-aminoethylamino)octanedioate.
| Compound Name | bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2-(2-aminoethylamino)octanedioate |
|---|---|
| PubChem CID | 68732883 |
| Molecular Formula | C32H48N2O8 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2-(2-aminoethylamino)octanedioate |
| SMILES | COc1cc(OC)cc(C(C)(C)OC(=O)CCCCCC(NCCN)C(=O)OC(C)(C)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C32H48N2O8/c1-31(2,22-16-24(37-5)20-25(17-22)38-6)41-29(35)13-11-9-10-12-28(34-15-14-33)30(36)42-32(3,4)23-18-26(39-7)21-27(19-23)40-8/h16-21,28,34H,9-15,33H2,1-8H3 |
| InChIKey | KNOWCXDXDFPRGY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|