C21H36O7SSi — CID 87574997
2-(3,5-dimethoxyphenyl)propan-2-yl 4-sulfanyl-2-triethoxysilylbutanoate (PubChem CID 87574997) has the molecular formula C21H36O7SSi and a molecular weight of 460.67 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)propan-2-yl 4-sulfanyl-2-triethoxysilylbutanoate.
| Compound Name | 2-(3,5-dimethoxyphenyl)propan-2-yl 4-sulfanyl-2-triethoxysilylbutanoate |
|---|---|
| PubChem CID | 87574997 |
| Molecular Formula | C21H36O7SSi |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)propan-2-yl 4-sulfanyl-2-triethoxysilylbutanoate |
| SMILES | CCO[Si](OCC)(OCC)C(CCS)C(=O)OC(C)(C)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H36O7SSi/c1-8-25-30(26-9-2,27-10-3)19(11-12-29)20(22)28-21(4,5)16-13-17(23-6)15-18(14-16)24-7/h13-15,19,29H,8-12H2,1-7H3 |
| InChIKey | NNTRDPARPYGFDB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|