C13H17NO6 — CID 57022293
carbamoyl 2-(3,5-dimethoxyphenyl)propan-2-yl carbonate (PubChem CID 57022293) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is carbamoyl 2-(3,5-dimethoxyphenyl)propan-2-yl carbonate.
| Compound Name | carbamoyl 2-(3,5-dimethoxyphenyl)propan-2-yl carbonate |
|---|---|
| PubChem CID | 57022293 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | carbamoyl 2-(3,5-dimethoxyphenyl)propan-2-yl carbonate |
| SMILES | COc1cc(OC)cc(C(C)(C)OC(=O)OC(N)=O)c1 |
| InChI | InChI=1S/C13H17NO6/c1-13(2,20-12(16)19-11(14)15)8-5-9(17-3)7-10(6-8)18-4/h5-7H,1-4H3,(H2,14,15) |
| InChIKey | RRANZBFKFZZTDE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|