C30H44N2O8 — CID 141238719
bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2,2-diamino-3-butylbutanedioate (PubChem CID 141238719) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2,2-diamino-3-butylbutanedioate.
| Compound Name | bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2,2-diamino-3-butylbutanedioate |
|---|---|
| PubChem CID | 141238719 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | bis[2-(3,5-dimethoxyphenyl)propan-2-yl] 2,2-diamino-3-butylbutanedioate |
| SMILES | CCCCC(C(=O)OC(C)(C)c1cc(OC)cc(OC)c1)C(N)(N)C(=O)OC(C)(C)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C30H44N2O8/c1-10-11-12-25(26(33)39-28(2,3)19-13-21(35-6)17-22(14-19)36-7)30(31,32)27(34)40-29(4,5)20-15-23(37-8)18-24(16-20)38-9/h13-18,25H,10-12,31-32H2,1-9H3 |
| InChIKey | MKVOJLQAAOWHQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|