C26H43N5O8 — CID 53254464
2-(3,5-dimethoxyphenyl)propan-2-yl N-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]carbamate (PubChem CID 53254464) has the molecular formula C26H43N5O8 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)propan-2-yl N-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]carbamate.
| Compound Name | 2-(3,5-dimethoxyphenyl)propan-2-yl N-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]carbamate |
|---|---|
| PubChem CID | 53254464 |
| Molecular Formula | C26H43N5O8 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)propan-2-yl N-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]carbamate |
| SMILES | COc1cc(OC)cc(C(C)(C)OC(=O)NNCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H43N5O8/c1-24(2,3)37-21(32)29-20(30-22(33)38-25(4,5)6)27-12-11-13-28-31-23(34)39-26(7,8)17-14-18(35-9)16-19(15-17)36-10/h14-16,28H,11-13H2,1-10H3,(H,31,34)(H2,27,29,30,32,33) |
| InChIKey | ILUXQUUQQYRJMD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|