C24H33N3O — CID 68734752
1,3-bis(azepan-2-yl)-4-methylnaphthalene-2-carboxamide (PubChem CID 68734752) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 1,3-bis(azepan-2-yl)-4-methylnaphthalene-2-carboxamide.
| Compound Name | 1,3-bis(azepan-2-yl)-4-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 68734752 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 1,3-bis(azepan-2-yl)-4-methylnaphthalene-2-carboxamide |
| SMILES | Cc1c(C2CCCCCN2)c(C(N)=O)c(C2CCCCCN2)c2ccccc12 |
| InChI | InChI=1S/C24H33N3O/c1-16-17-10-6-7-11-18(17)22(20-13-5-3-9-15-27-20)23(24(25)28)21(16)19-12-4-2-8-14-26-19/h6-7,10-11,19-20,26-27H,2-5,8-9,12-15H2,1H3,(H2,25,28) |
| InChIKey | ZPXZMTNVMNXKFZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |