About 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine
2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine (PubChem CID 68738414) has the molecular formula C12H13BrN2
and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine.
Molecular Properties
| Compound Name | 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine |
| PubChem CID | 68738414 |
| Molecular Formula | C12H13BrN2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine |
| SMILES | NC(N)Cc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C12H13BrN2/c13-12-9(7-11(14)15)6-5-8-3-1-2-4-10(8)12/h1-6,11H,7,14-15H2 |
| InChIKey | SADDNBPDHDPCAP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine?
The IUPAC name of 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine (CID 68738414) is 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine.
What is the SMILES notation for 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine?
The canonical SMILES for 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine is NC(N)Cc1ccc2ccccc2c1Br.
What is the InChIKey of 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine?
The InChIKey is SADDNBPDHDPCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2/c13-12-9(7-11(14)15)6-5-8-3-1-2-4-10(8)12/h1-6,11H,7,14-15H2.
What are the key properties of 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine?
2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine has a molecular weight of 265.15 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromonaphthalen-2-yl)ethane-1,1-diamine is sourced from PubChem (CID 68738414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).