C22H26N6O2S — CID 68739075
N-(3-imidazol-1-ylpropyl)-6-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 68739075) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68739075 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccsc1C(=O)N1CCN(c2ccc(C(=O)NCCCn3ccnc3)cn2)CC1 |
| InChI | InChI=1S/C22H26N6O2S/c1-17-5-14-31-20(17)22(30)28-12-10-27(11-13-28)19-4-3-18(15-25-19)21(29)24-6-2-8-26-9-7-23-16-26/h3-5,7,9,14-16H,2,6,8,10-13H2,1H3,(H,24,29) |
| InChIKey | SNWBXSCZEACNKU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|