C20H28OSi — CID 68744008
[3-[1-(2-methoxyphenyl)cyclopentyl]cyclopenta-2,4-dien-1-yl]-trimethylsilane (PubChem CID 68744008) has the molecular formula C20H28OSi and a molecular weight of 312.53 g/mol. Its IUPAC name is [3-[1-(2-methoxyphenyl)cyclopentyl]cyclopenta-2,4-dien-1-yl]-trimethylsilane.
| Compound Name | [3-[1-(2-methoxyphenyl)cyclopentyl]cyclopenta-2,4-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 68744008 |
| Molecular Formula | C20H28OSi |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [3-[1-(2-methoxyphenyl)cyclopentyl]cyclopenta-2,4-dien-1-yl]-trimethylsilane |
| SMILES | COc1ccccc1C1(C2=CC([Si](C)(C)C)C=C2)CCCC1 |
| InChI | InChI=1S/C20H28OSi/c1-21-19-10-6-5-9-18(19)20(13-7-8-14-20)16-11-12-17(15-16)22(2,3)4/h5-6,9-12,15,17H,7-8,13-14H2,1-4H3 |
| InChIKey | UVDSQQTUGZEOKM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|