C25H35N3O — CID 68744034
3-[2-[2-(dimethylamino)ethylamino]phenyl]-1-[3-(dipropylamino)phenyl]prop-2-en-1-one (PubChem CID 68744034) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethylamino]phenyl]-1-[3-(dipropylamino)phenyl]prop-2-en-1-one.
| Compound Name | 3-[2-[2-(dimethylamino)ethylamino]phenyl]-1-[3-(dipropylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744034 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethylamino]phenyl]-1-[3-(dipropylamino)phenyl]prop-2-en-1-one |
| SMILES | CCCN(CCC)c1cccc(C(=O)C=Cc2ccccc2NCCN(C)C)c1 |
| InChI | InChI=1S/C25H35N3O/c1-5-17-28(18-6-2)23-12-9-11-22(20-23)25(29)15-14-21-10-7-8-13-24(21)26-16-19-27(3)4/h7-15,20,26H,5-6,16-19H2,1-4H3 |
| InChIKey | OCUTUEXBSQPEOF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|