About N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine
N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine (PubChem CID 68744970) has the molecular formula C22H46N2
and a molecular weight of 338.62 g/mol. Its IUPAC name is N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine |
| PubChem CID | 68744970 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine |
| SMILES | CC(C)C(C(C)C)N(CC1CCCC(CN)C1)C(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46N2/c1-15(2)21(16(3)4)24(22(17(5)6)18(7)8)14-20-11-9-10-19(12-20)13-23/h15-22H,9-14,23H2,1-8H3 |
| InChIKey | WLRLURBYGYVBPA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine?
The IUPAC name of N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine (CID 68744970) is N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine.
What is the SMILES notation for N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine?
The canonical SMILES for N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine is CC(C)C(C(C)C)N(CC1CCCC(CN)C1)C(C(C)C)C(C)C.
What is the InChIKey of N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine?
The InChIKey is WLRLURBYGYVBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46N2/c1-15(2)21(16(3)4)24(22(17(5)6)18(7)8)14-20-11-9-10-19(12-20)13-23/h15-22H,9-14,23H2,1-8H3.
What are the key properties of N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine?
N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine has a molecular weight of 338.62 g/mol, XLogP of 5.41, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(aminomethyl)cyclohexyl]methyl]-N-(2,4-dimethylpentan-3-yl)-2,4-dimethylpentan-3-amine is sourced from PubChem (CID 68744970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).