C19H21N5O5 — CID 68746377
2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)benzamide (PubChem CID 68746377) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)benzamide.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 68746377 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)benzamide |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)Nc1ccccc1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N5O5/c1-11(20)17(25)21-12(2)18(26)23-16-6-4-3-5-15(16)19(27)22-13-7-9-14(10-8-13)24(28)29/h3-12H,20H2,1-2H3,(H,21,25)(H,22,27)(H,23,26)/t11-,12-/m0/s1 |
| InChIKey | FMKURCYPCOEWAU-RYUDHWBXSA-N |
| XLogP | 1.64 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|