C22H36N6O5 — CID 10813985
(2S)-2-[[(2S)-2-amino-3-methylbutyl]amino]-3-methyl-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]butanamide (PubChem CID 10813985) has the molecular formula C22H36N6O5 and a molecular weight of 464.57 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-methylbutyl]amino]-3-methyl-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]butanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-methylbutyl]amino]-3-methyl-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 10813985 |
| Molecular Formula | C22H36N6O5 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutyl]amino]-3-methyl-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]butanamide |
| SMILES | CC(C)[C@H](N)CN[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C22H36N6O5/c1-12(2)18(23)11-24-19(13(3)4)22(31)26-14(5)20(29)25-15(6)21(30)27-16-7-9-17(10-8-16)28(32)33/h7-10,12-15,18-19,24H,11,23H2,1-6H3,(H,25,29)(H,26,31)(H,27,30)/t14-,15-,18+,19-/m0/s1 |
| InChIKey | LKFODTLCHBRKJL-SAKMYQHLSA-N |
| XLogP | 1.14 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|