C14H20N4O6 — CID 95566048
(2S,3R)-2-amino-3-hydroxy-N-[(2S,3S)-3-hydroxy-1-(4-nitroanilino)-1-oxobutan-2-yl]butanamide (PubChem CID 95566048) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-[(2S,3S)-3-hydroxy-1-(4-nitroanilino)-1-oxobutan-2-yl]butanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-[(2S,3S)-3-hydroxy-1-(4-nitroanilino)-1-oxobutan-2-yl]butanamide |
|---|---|
| PubChem CID | 95566048 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-[(2S,3S)-3-hydroxy-1-(4-nitroanilino)-1-oxobutan-2-yl]butanamide |
| SMILES | C[C@H](O)[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O6/c1-7(19)11(15)13(21)17-12(8(2)20)14(22)16-9-3-5-10(6-4-9)18(23)24/h3-8,11-12,19-20H,15H2,1-2H3,(H,16,22)(H,17,21)/t7-,8+,11+,12+/m1/s1 |
| InChIKey | DFUSHSVTCFOXPE-ULCXWNMLSA-N |
| XLogP | -0.89 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|