C15H25NO4 — CID 68746440
2-amino-2-cyclopentyloxycarbonylnon-8-enoic acid (PubChem CID 68746440) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-amino-2-cyclopentyloxycarbonylnon-8-enoic acid.
| Compound Name | 2-amino-2-cyclopentyloxycarbonylnon-8-enoic acid |
|---|---|
| PubChem CID | 68746440 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-amino-2-cyclopentyloxycarbonylnon-8-enoic acid |
| SMILES | C=CCCCCCC(N)(C(=O)O)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C15H25NO4/c1-2-3-4-5-8-11-15(16,13(17)18)14(19)20-12-9-6-7-10-12/h2,12H,1,3-11,16H2,(H,17,18) |
| InChIKey | IBUYQPFLYLTLDS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|