About N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine
N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine (PubChem CID 68746503) has the molecular formula C21H20N4
and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine.
Molecular Properties
| Compound Name | N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine |
| PubChem CID | 68746503 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine |
| SMILES | Cc1cc(/N=C/c2ccccn2)c(C)cc1/N=C/Cc1ccccn1 |
| InChI | InChI=1S/C21H20N4/c1-16-14-21(25-15-19-8-4-6-11-23-19)17(2)13-20(16)24-12-9-18-7-3-5-10-22-18/h3-8,10-15H,9H2,1-2H3/b24-12+,25-15+ |
| InChIKey | QADOOTXAHJHHBW-WPMHRMROSA-N |
| XLogP | 4.79 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine?
The IUPAC name of N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine (CID 68746503) is N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine.
What is the SMILES notation for N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine?
The canonical SMILES for N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine is Cc1cc(/N=C/c2ccccn2)c(C)cc1/N=C/Cc1ccccn1.
What is the InChIKey of N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine?
The InChIKey is QADOOTXAHJHHBW-WPMHRMROSA-N. The full InChI is InChI=1S/C21H20N4/c1-16-14-21(25-15-19-8-4-6-11-23-19)17(2)13-20(16)24-12-9-18-7-3-5-10-22-18/h3-8,10-15H,9H2,1-2H3/b24-12+,25-15+.
What are the key properties of N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine?
N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine has a molecular weight of 328.42 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dimethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-2-pyridin-2-ylethanimine is sourced from PubChem (CID 68746503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).