C22H22N4 — CID 68747629
N-[2,5-dimethyl-4-(2-pyridin-2-ylethylideneamino)phenyl]-2-pyridin-2-ylethanimine (PubChem CID 68747629) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-(2-pyridin-2-ylethylideneamino)phenyl]-2-pyridin-2-ylethanimine.
| Compound Name | N-[2,5-dimethyl-4-(2-pyridin-2-ylethylideneamino)phenyl]-2-pyridin-2-ylethanimine |
|---|---|
| PubChem CID | 68747629 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[2,5-dimethyl-4-(2-pyridin-2-ylethylideneamino)phenyl]-2-pyridin-2-ylethanimine |
| SMILES | Cc1cc(/N=C/Cc2ccccn2)c(C)cc1/N=C/Cc1ccccn1 |
| InChI | InChI=1S/C22H22N4/c1-17-15-22(26-14-10-20-8-4-6-12-24-20)18(2)16-21(17)25-13-9-19-7-3-5-11-23-19/h3-8,11-16H,9-10H2,1-2H3/b25-13+,26-14+ |
| InChIKey | DRSCTZQRWGULFN-BKHCZYBLSA-N |
| XLogP | 4.98 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|