C36H50N2NiO3 — CID 160633623
3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-2-pyridin-2-ylethanimine;nickel(2+) (PubChem CID 160633623) has the molecular formula C36H50N2NiO3 and a molecular weight of 617.50 g/mol. Its IUPAC name is 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-2-pyridin-2-ylethanimine;nickel(2+).
| Compound Name | 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-2-pyridin-2-ylethanimine;nickel(2+) |
|---|---|
| PubChem CID | 160633623 |
| Molecular Formula | C36H50N2NiO3 |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-2-pyridin-2-ylethanimine;nickel(2+) |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(/N=C/Cc2ccccn2)c1.COc1cc(C(C)(C)C)c([O-])c([O-])c1C(C)(C)C.[Ni+2] |
| InChI | InChI=1S/C21H28N2.C15H24O3.Ni/c1-20(2,3)16-10-11-18(21(4,5)6)19(15-16)23-14-12-17-9-7-8-13-22-17;1-14(2,3)9-8-10(18-7)11(15(4,5)6)13(17)12(9)16;/h7-11,13-15H,12H2,1-6H3;8,16-17H,1-7H3;/q;;+2/p-2/b23-14+;; |
| InChIKey | RIFYURCFEJBDJC-PQZUSRQGSA-L |
| XLogP | 8.06 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|