C35H48N2NiO3 — CID 161207320
3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) (PubChem CID 161207320) has the molecular formula C35H48N2NiO3 and a molecular weight of 603.47 g/mol. Its IUPAC name is 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+).
| Compound Name | 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) |
|---|---|
| PubChem CID | 161207320 |
| Molecular Formula | C35H48N2NiO3 |
| Molecular Weight | 603.47 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 3,6-ditert-butyl-4-methoxybenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(/N=C/c2ccccn2)c1.COc1cc(C(C)(C)C)c([O-])c([O-])c1C(C)(C)C.[Ni+2] |
| InChI | InChI=1S/C20H26N2.C15H24O3.Ni/c1-19(2,3)15-10-11-17(20(4,5)6)18(13-15)22-14-16-9-7-8-12-21-16;1-14(2,3)9-8-10(18-7)11(15(4,5)6)13(17)12(9)16;/h7-14H,1-6H3;8,16-17H,1-7H3;/q;;+2/p-2/b22-14+;; |
| InChIKey | UVTWEWWMVPCOKB-JYFUHLDJSA-L |
| XLogP | 7.86 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.47 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|