C18H21N3O3S — CID 23850129
N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-1-pyridin-2-ylmethanimine (PubChem CID 23850129) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-1-pyridin-2-ylmethanimine.
| Compound Name | N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 23850129 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-1-pyridin-2-ylmethanimine |
| SMILES | COc1cc(S(=O)(=O)N2CCCCC2)ccc1/N=C/c1ccccn1 |
| InChI | InChI=1S/C18H21N3O3S/c1-24-18-13-16(25(22,23)21-11-5-2-6-12-21)8-9-17(18)20-14-15-7-3-4-10-19-15/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3/b20-14+ |
| InChIKey | FQPNMJAOMDOTAB-XSFVSMFZSA-N |
| XLogP | 3.02 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|