C18H17Cl3N2O2S — CID 4176024
N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-1-(2,6-dichlorophenyl)methanimine (PubChem CID 4176024) has the molecular formula C18H17Cl3N2O2S and a molecular weight of 431.77 g/mol. Its IUPAC name is N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-1-(2,6-dichlorophenyl)methanimine.
| Compound Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-1-(2,6-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 4176024 |
| Molecular Formula | C18H17Cl3N2O2S |
| Molecular Weight | 431.77 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-1-(2,6-dichlorophenyl)methanimine |
| SMILES | O=S(=O)(c1ccc(Cl)c(/N=C/c2c(Cl)cccc2Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C18H17Cl3N2O2S/c19-15-5-4-6-16(20)14(15)12-22-18-11-13(7-8-17(18)21)26(24,25)23-9-2-1-3-10-23/h4-8,11-12H,1-3,9-10H2/b22-12+ |
| InChIKey | JEKOYVGJHUZSQZ-WSDLNYQXSA-N |
| XLogP | 5.57 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.77 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|