C28H34Cu2N2O2 — CID 158112797
bis(copper(1+));3,6-ditert-butylbenzene-1,2-diolate;N-(2,6-dimethylphenyl)-1-pyridin-2-ylmethanimine (PubChem CID 158112797) has the molecular formula C28H34Cu2N2O2 and a molecular weight of 557.68 g/mol. Its IUPAC name is bis(copper(1+));3,6-ditert-butylbenzene-1,2-diolate;N-(2,6-dimethylphenyl)-1-pyridin-2-ylmethanimine.
| Compound Name | bis(copper(1+));3,6-ditert-butylbenzene-1,2-diolate;N-(2,6-dimethylphenyl)-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 158112797 |
| Molecular Formula | C28H34Cu2N2O2 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | bis(copper(1+));3,6-ditert-butylbenzene-1,2-diolate;N-(2,6-dimethylphenyl)-1-pyridin-2-ylmethanimine |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c([O-])c1[O-].Cc1cccc(C)c1/N=C/c1ccccn1.[Cu+].[Cu+] |
| InChI | InChI=1S/C14H14N2.C14H22O2.2Cu/c1-11-6-5-7-12(2)14(11)16-10-13-8-3-4-9-15-13;1-13(2,3)9-7-8-10(14(4,5)6)12(16)11(9)15;;/h3-10H,1-2H3;7-8,15-16H,1-6H3;;/q;;2*+1/p-2/b16-10+;;; |
| InChIKey | FQQIUNDDZFOORK-BCSAYTTPSA-L |
| XLogP | 5.87 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|