C34H46N2NiO2 — CID 158275751
3,6-ditert-butylbenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) (PubChem CID 158275751) has the molecular formula C34H46N2NiO2 and a molecular weight of 573.45 g/mol. Its IUPAC name is 3,6-ditert-butylbenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+).
| Compound Name | 3,6-ditert-butylbenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) |
|---|---|
| PubChem CID | 158275751 |
| Molecular Formula | C34H46N2NiO2 |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 3,6-ditert-butylbenzene-1,2-diolate;N-(2,5-ditert-butylphenyl)-1-pyridin-2-ylmethanimine;nickel(2+) |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(/N=C/c2ccccn2)c1.CC(C)(C)c1ccc(C(C)(C)C)c([O-])c1[O-].[Ni+2] |
| InChI | InChI=1S/C20H26N2.C14H22O2.Ni/c1-19(2,3)15-10-11-17(20(4,5)6)18(13-15)22-14-16-9-7-8-12-21-16;1-13(2,3)9-7-8-10(14(4,5)6)12(16)11(9)15;/h7-14H,1-6H3;7-8,15-16H,1-6H3;/q;;+2/p-2/b22-14+;; |
| InChIKey | GJOVSOMXUFGCIX-JYFUHLDJSA-L |
| XLogP | 7.85 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|