C24H30N4O3S — CID 68750613
(17-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) 4-methylthiadiazole-5-carboxylate (PubChem CID 68750613) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is (17-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) 4-methylthiadiazole-5-carboxylate.
| Compound Name | (17-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) 4-methylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 68750613 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (17-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) 4-methylthiadiazole-5-carboxylate |
| SMILES | Cc1nnsc1C(=O)OC1(O)CCC2C3CCC4=Cc5[nH]ncc5CC4(C)C3CCC21C |
| InChI | InChI=1S/C24H30N4O3S/c1-13-20(32-28-26-13)21(29)31-24(30)9-7-18-16-5-4-15-10-19-14(12-25-27-19)11-22(15,2)17(16)6-8-23(18,24)3/h10,12,16-18,30H,4-9,11H2,1-3H3,(H,25,27) |
| InChIKey | XLIXBNTVOWJTDA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|