C20H28N2O2 — CID 142985137
(17R)-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17,20-diol (PubChem CID 142985137) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (17R)-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17,20-diol.
| Compound Name | (17R)-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17,20-diol |
|---|---|
| PubChem CID | 142985137 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (17R)-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17,20-diol |
| SMILES | CC12Cc3cn[nH]c3C=C1CCC1C2C(O)CC2(C)C1CC[C@H]2O |
| InChI | InChI=1S/C20H28N2O2/c1-19-8-11-10-21-22-15(11)7-12(19)3-4-13-14-5-6-17(24)20(14,2)9-16(23)18(13)19/h7,10,13-14,16-18,23-24H,3-6,8-9H2,1-2H3,(H,21,22)/t13?,14?,16?,17-,18?,19?,20?/m1/s1 |
| InChIKey | BGEHDDLPVRJZIR-SLXHYUKOSA-N |
| XLogP | 2.92 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |