C14H15BrN2O4 — CID 68750807
3-hydroxypropyl 6-bromo-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 68750807) has the molecular formula C14H15BrN2O4 and a molecular weight of 355.19 g/mol. Its IUPAC name is 3-hydroxypropyl 6-bromo-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | 3-hydroxypropyl 6-bromo-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 68750807 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 3-hydroxypropyl 6-bromo-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCn1cc(C(=O)OCCCO)c(=O)c2cc(Br)cnc21 |
| InChI | InChI=1S/C14H15BrN2O4/c1-2-17-8-11(14(20)21-5-3-4-18)12(19)10-6-9(15)7-16-13(10)17/h6-8,18H,2-5H2,1H3 |
| InChIKey | FYBDEZFYCXFPIH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|