C26H21BrN2O6 — CID 6875141
ethyl 4-[5-[(E)-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 6875141) has the molecular formula C26H21BrN2O6 and a molecular weight of 537.37 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6875141 |
| Molecular Formula | C26H21BrN2O6 |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | ethyl 4-[5-[(E)-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N/NC(=O)c3ccc(COc4ccc(Br)cc4)o3)o2)cc1 |
| InChI | InChI=1S/C26H21BrN2O6/c1-2-32-26(31)18-5-3-17(4-6-18)23-13-11-21(34-23)15-28-29-25(30)24-14-12-22(35-24)16-33-20-9-7-19(27)8-10-20/h3-15H,2,16H2,1H3,(H,29,30)/b28-15+ |
| InChIKey | TWTLDZQFSGZOJJ-RWPZCVJISA-N |
| XLogP | 5.82 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|