C31H27N3O6 — CID 126414321
methyl 2-[5-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126414321) has the molecular formula C31H27N3O6 and a molecular weight of 537.57 g/mol. Its IUPAC name is methyl 2-[5-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126414321 |
| Molecular Formula | C31H27N3O6 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | methyl 2-[5-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)o1 |
| InChI | InChI=1S/C31H27N3O6/c1-20-8-9-21(2)34(20)22-10-12-23(13-11-22)38-19-25-15-17-29(40-25)30(35)33-32-18-24-14-16-28(39-24)26-6-4-5-7-27(26)31(36)37-3/h4-18H,19H2,1-3H3,(H,33,35)/b32-18+ |
| InChIKey | SFJWAKVAGUOQET-KCSSXMTESA-N |
| XLogP | 6.08 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|