C17H26N3O3+ — CID 68756337
(3S)-1-tert-butyl-3-methyl-4-(phenylcarbamoyl)piperazin-1-ium-1-carboxylic acid (PubChem CID 68756337) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is (3S)-1-tert-butyl-3-methyl-4-(phenylcarbamoyl)piperazin-1-ium-1-carboxylic acid.
| Compound Name | (3S)-1-tert-butyl-3-methyl-4-(phenylcarbamoyl)piperazin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 68756337 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (3S)-1-tert-butyl-3-methyl-4-(phenylcarbamoyl)piperazin-1-ium-1-carboxylic acid |
| SMILES | C[C@H]1C[N+](C(=O)O)(C(C)(C)C)CCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-13-12-20(16(22)23,17(2,3)4)11-10-19(13)15(21)18-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3,(H-,18,21,22,23)/p+1/t13-,20?/m0/s1 |
| InChIKey | FSHDAJVCNBXPAF-SZQRVLIRSA-O |
| XLogP | 3.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|