About (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid (PubChem CID 68756865) has the molecular formula C9H9BrN4O2
and a molecular weight of 285.10 g/mol. Its IUPAC name is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid.
Molecular Properties
| Compound Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid |
| PubChem CID | 68756865 |
| Molecular Formula | C9H9BrN4O2 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid |
| SMILES | CN(Cc1nc2ncc(Br)cc2[nH]1)C(=O)O |
| InChI | InChI=1S/C9H9BrN4O2/c1-14(9(15)16)4-7-12-6-2-5(10)3-11-8(6)13-7/h2-3H,4H2,1H3,(H,15,16)(H,11,12,13) |
| InChIKey | AOCUFSCAEIFTHR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid?
The IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid (CID 68756865) is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid.
What is the SMILES notation for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid?
The canonical SMILES for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid is CN(Cc1nc2ncc(Br)cc2[nH]1)C(=O)O.
What is the InChIKey of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid?
The InChIKey is AOCUFSCAEIFTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4O2/c1-14(9(15)16)4-7-12-6-2-5(10)3-11-8(6)13-7/h2-3H,4H2,1H3,(H,15,16)(H,11,12,13).
What are the key properties of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid?
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid has a molecular weight of 285.10 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl-methylcarbamic acid is sourced from PubChem (CID 68756865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).