C29H24N4O5 — CID 6875982
2-methyl-N-[2-[[(E)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 6875982) has the molecular formula C29H24N4O5 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-methyl-N-[2-[[(E)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-methyl-N-[2-[[(E)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6875982 |
| Molecular Formula | C29H24N4O5 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-methyl-N-[2-[[(E)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccccc1C(=O)N/N=C/c1ccccc1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N4O5/c1-20-10-2-5-13-23(20)28(34)31-25-15-7-6-14-24(25)29(35)32-30-18-21-11-4-9-17-27(21)38-19-22-12-3-8-16-26(22)33(36)37/h2-18H,19H2,1H3,(H,31,34)(H,32,35)/b30-18+ |
| InChIKey | IDUNXWDILGIFGV-UXHLAJHPSA-N |
| XLogP | 5.50 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|