C31H37N3O5 — CID 6274766
4-decoxy-N-[(Z)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 6274766) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-decoxy-N-[(Z)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-decoxy-N-[(Z)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6274766 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 4-decoxy-N-[(Z)-[2-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)N/N=C\c2ccccc2OCc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H37N3O5/c1-2-3-4-5-6-7-8-13-22-38-28-20-18-25(19-21-28)31(35)33-32-23-26-14-10-12-17-30(26)39-24-27-15-9-11-16-29(27)34(36)37/h9-12,14-21,23H,2-8,13,22,24H2,1H3,(H,33,35)/b32-23- |
| InChIKey | YTDOEEHCBGRKRM-SJIPCVTESA-N |
| XLogP | 7.46 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|