C25H26Cl2N4O — CID 68760755
2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3,5-dichlorophenyl)-2-naphthalen-1-ylacetohydrazide (PubChem CID 68760755) has the molecular formula C25H26Cl2N4O and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3,5-dichlorophenyl)-2-naphthalen-1-ylacetohydrazide.
| Compound Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3,5-dichlorophenyl)-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 68760755 |
| Molecular Formula | C25H26Cl2N4O |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3,5-dichlorophenyl)-2-naphthalen-1-ylacetohydrazide |
| SMILES | NN(C(=O)C(c1cccc2ccccc12)N1CCN2CCC[C@H]2C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H26Cl2N4O/c26-18-13-19(27)15-21(14-18)31(28)25(32)24(30-12-11-29-10-4-7-20(29)16-30)23-9-3-6-17-5-1-2-8-22(17)23/h1-3,5-6,8-9,13-15,20,24H,4,7,10-12,16,28H2/t20-,24?/m0/s1 |
| InChIKey | UBGJGDKBZWSCML-QHELBMECSA-N |
| XLogP | 4.87 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|