C24H25Cl2N3O — CID 25125233
N'-(3,5-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-2-naphthalen-1-ylacetohydrazide (PubChem CID 25125233) has the molecular formula C24H25Cl2N3O and a molecular weight of 442.39 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-2-naphthalen-1-ylacetohydrazide.
| Compound Name | N'-(3,5-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 25125233 |
| Molecular Formula | C24H25Cl2N3O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-2-naphthalen-1-ylacetohydrazide |
| SMILES | CN1CCC(C(C(=O)NNc2cc(Cl)cc(Cl)c2)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H25Cl2N3O/c1-29-11-9-17(10-12-29)23(22-8-4-6-16-5-2-3-7-21(16)22)24(30)28-27-20-14-18(25)13-19(26)15-20/h2-8,13-15,17,23,27H,9-12H2,1H3,(H,28,30) |
| InChIKey | NACQEUUUPMSZID-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|