C27H27Cl2N3O3S — CID 90706019
2-dibenzothiophen-4-yl-N-[(3,5-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)acetamide;formic acid (PubChem CID 90706019) has the molecular formula C27H27Cl2N3O3S and a molecular weight of 544.50 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-N-[(3,5-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)acetamide;formic acid.
| Compound Name | 2-dibenzothiophen-4-yl-N-[(3,5-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)acetamide;formic acid |
|---|---|
| PubChem CID | 90706019 |
| Molecular Formula | C27H27Cl2N3O3S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 2-dibenzothiophen-4-yl-N-[(3,5-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)acetamide;formic acid |
| SMILES | CN1CCN(C(C(=O)NCc2cc(Cl)cc(Cl)c2)c2cccc3c2sc2ccccc23)CC1.O=CO |
| InChI | InChI=1S/C26H25Cl2N3OS.CH2O2/c1-30-9-11-31(12-10-30)24(26(32)29-16-17-13-18(27)15-19(28)14-17)22-7-4-6-21-20-5-2-3-8-23(20)33-25(21)22;2-1-3/h2-8,13-15,24H,9-12,16H2,1H3,(H,29,32);1H,(H,2,3) |
| InChIKey | AUPAZJARNMXGEY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|