C20H21Cl2F3N4O2 — CID 25123241
N'-(3,5-dichlorophenyl)-2-(4-methylpiperazin-1-yl)-2-[4-(trifluoromethoxy)phenyl]acetohydrazide (PubChem CID 25123241) has the molecular formula C20H21Cl2F3N4O2 and a molecular weight of 477.31 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-2-(4-methylpiperazin-1-yl)-2-[4-(trifluoromethoxy)phenyl]acetohydrazide.
| Compound Name | N'-(3,5-dichlorophenyl)-2-(4-methylpiperazin-1-yl)-2-[4-(trifluoromethoxy)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 25123241 |
| Molecular Formula | C20H21Cl2F3N4O2 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-2-(4-methylpiperazin-1-yl)-2-[4-(trifluoromethoxy)phenyl]acetohydrazide |
| SMILES | CN1CCN(C(C(=O)NNc2cc(Cl)cc(Cl)c2)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H21Cl2F3N4O2/c1-28-6-8-29(9-7-28)18(13-2-4-17(5-3-13)31-20(23,24)25)19(30)27-26-16-11-14(21)10-15(22)12-16/h2-5,10-12,18,26H,6-9H2,1H3,(H,27,30) |
| InChIKey | ARFBYMDTMFAEHW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|