C22H25F6N5O — CID 86647530
N'-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethyl-3-pyridinyl)-2-(4-methylpiperazin-1-yl)acetohydrazide (PubChem CID 86647530) has the molecular formula C22H25F6N5O and a molecular weight of 489.46 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethyl-3-pyridinyl)-2-(4-methylpiperazin-1-yl)acetohydrazide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethyl-3-pyridinyl)-2-(4-methylpiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 86647530 |
| Molecular Formula | C22H25F6N5O |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethyl-3-pyridinyl)-2-(4-methylpiperazin-1-yl)acetohydrazide |
| SMILES | Cc1ccc(C(C(=O)NNc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N2CCN(C)CC2)c(C)n1 |
| InChI | InChI=1S/C22H25F6N5O/c1-13-4-5-18(14(2)29-13)19(33-8-6-32(3)7-9-33)20(34)31-30-17-11-15(21(23,24)25)10-16(12-17)22(26,27)28/h4-5,10-12,19,30H,6-9H2,1-3H3,(H,31,34) |
| InChIKey | MLESOEMOAFAISA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|